C10H10N2O5 — CID 171371576
2-(4,5-dimethoxy-2-nitrophenyl)-2-hydroxyacetonitrile (PubChem CID 171371576) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)-2-hydroxyacetonitrile.
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)-2-hydroxyacetonitrile |
|---|---|
| PubChem CID | 171371576 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)-2-hydroxyacetonitrile |
| SMILES | COc1cc(C(O)C#N)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H10N2O5/c1-16-9-3-6(8(13)5-11)7(12(14)15)4-10(9)17-2/h3-4,8,13H,1-2H3 |
| InChIKey | QJFYLJBVLXRDMI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|