C12H17NO5 — CID 83008421
3-(4,5-dimethoxy-2-nitrophenyl)butan-2-ol (PubChem CID 83008421) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-(4,5-dimethoxy-2-nitrophenyl)butan-2-ol.
| Compound Name | 3-(4,5-dimethoxy-2-nitrophenyl)butan-2-ol |
|---|---|
| PubChem CID | 83008421 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-(4,5-dimethoxy-2-nitrophenyl)butan-2-ol |
| SMILES | COc1cc(C(C)C(C)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H17NO5/c1-7(8(2)14)9-5-11(17-3)12(18-4)6-10(9)13(15)16/h5-8,14H,1-4H3 |
| InChIKey | GBSHUBXVUAMLHV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|