C10H12N2O6 — CID 53419103
2-amino-2-(4,5-dimethoxy-2-nitrophenyl)acetic acid (PubChem CID 53419103) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is 2-amino-2-(4,5-dimethoxy-2-nitrophenyl)acetic acid.
| Compound Name | 2-amino-2-(4,5-dimethoxy-2-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 53419103 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-amino-2-(4,5-dimethoxy-2-nitrophenyl)acetic acid |
| SMILES | COc1cc(C(N)C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C10H12N2O6/c1-17-7-3-5(9(11)10(13)14)6(12(15)16)4-8(7)18-2/h3-4,9H,11H2,1-2H3,(H,13,14) |
| InChIKey | SCJSOFHQWFRHDI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|