C8H6F2N2O4 — CID 66512904
(2S)-2-amino-2-(4,5-difluoro-2-nitrophenyl)acetic acid (PubChem CID 66512904) has the molecular formula C8H6F2N2O4 and a molecular weight of 232.14 g/mol. Its IUPAC name is (2S)-2-amino-2-(4,5-difluoro-2-nitrophenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(4,5-difluoro-2-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 66512904 |
| Molecular Formula | C8H6F2N2O4 |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (2S)-2-amino-2-(4,5-difluoro-2-nitrophenyl)acetic acid |
| SMILES | N[C@H](C(=O)O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6F2N2O4/c9-4-1-3(7(11)8(13)14)6(12(15)16)2-5(4)10/h1-2,7H,11H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | GWGRKRRMOBYDBM-ZETCQYMHSA-N |
| XLogP | 0.96 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|