C8H6F3NO4 — CID 174830046
acetic acid;1,2,4-trifluoro-5-nitrobenzene (PubChem CID 174830046) has the molecular formula C8H6F3NO4 and a molecular weight of 237.13 g/mol. Its IUPAC name is acetic acid;1,2,4-trifluoro-5-nitrobenzene.
| Compound Name | acetic acid;1,2,4-trifluoro-5-nitrobenzene |
|---|---|
| PubChem CID | 174830046 |
| Molecular Formula | C8H6F3NO4 |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | acetic acid;1,2,4-trifluoro-5-nitrobenzene |
| SMILES | CC(=O)O.O=[N+]([O-])c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C6H2F3NO2.C2H4O2/c7-3-1-5(9)6(10(11)12)2-4(3)8;1-2(3)4/h1-2H;1H3,(H,3,4) |
| InChIKey | NOANCEMXRZLFKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|