C8H5F2NO4 — CID 174766654
(2,4-difluoro-5-nitrophenyl) acetate (PubChem CID 174766654) has the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. Its IUPAC name is (2,4-difluoro-5-nitrophenyl) acetate.
| Compound Name | (2,4-difluoro-5-nitrophenyl) acetate |
|---|---|
| PubChem CID | 174766654 |
| Molecular Formula | C8H5F2NO4 |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | (2,4-difluoro-5-nitrophenyl) acetate |
| SMILES | CC(=O)Oc1cc([N+](=O)[O-])c(F)cc1F |
| InChI | InChI=1S/C8H5F2NO4/c1-4(12)15-8-3-7(11(13)14)5(9)2-6(8)10/h2-3H,1H3 |
| InChIKey | KSNHNBZLMSKMEW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|