C7H2F5NO5S — CID 122361170
(2,4-difluoro-5-nitrophenyl) trifluoromethanesulfonate (PubChem CID 122361170) has the molecular formula C7H2F5NO5S and a molecular weight of 307.15 g/mol. Its IUPAC name is (2,4-difluoro-5-nitrophenyl) trifluoromethanesulfonate.
| Compound Name | (2,4-difluoro-5-nitrophenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122361170 |
| Molecular Formula | C7H2F5NO5S |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | (2,4-difluoro-5-nitrophenyl) trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1cc(OS(=O)(=O)C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C7H2F5NO5S/c8-3-1-4(9)6(2-5(3)13(14)15)18-19(16,17)7(10,11)12/h1-2H |
| InChIKey | ZATQUEIKLSGBDO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|