About 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate
4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate (PubChem CID 159413937) has the molecular formula C16H11F5N2O7S
and a molecular weight of 470.33 g/mol. Its IUPAC name is 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate |
| PubChem CID | 159413937 |
| Molecular Formula | C16H11F5N2O7S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1ccc(C2CC2)cc1F.O=[N+]([O-])c1ccc(OS(=O)(=O)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H8FNO2.C7H3F4NO5S/c10-8-5-7(6-1-2-6)3-4-9(8)11(12)13;8-5-3-4(1-2-6(5)12(13)14)17-18(15,16)7(9,10)11/h3-6H,1-2H2;1-3H |
| InChIKey | LOXRDUBIGJDLGO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate?
The IUPAC name of 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate (CID 159413937) is 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate.
What is the SMILES notation for 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate?
The canonical SMILES for 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate is O=[N+]([O-])c1ccc(C2CC2)cc1F.O=[N+]([O-])c1ccc(OS(=O)(=O)C(F)(F)F)cc1F.
What is the InChIKey of 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate?
The InChIKey is LOXRDUBIGJDLGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2.C7H3F4NO5S/c10-8-5-7(6-1-2-6)3-4-9(8)11(12)13;8-5-3-4(1-2-6(5)12(13)14)17-18(15,16)7(9,10)11/h3-6H,1-2H2;1-3H.
What are the key properties of 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate?
4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate has a molecular weight of 470.33 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-fluoro-1-nitrobenzene;(3-fluoro-4-nitrophenyl) trifluoromethanesulfonate is sourced from PubChem (CID 159413937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).