About (5-chloro-2-nitrophenyl) trifluoromethanesulfonate
(5-chloro-2-nitrophenyl) trifluoromethanesulfonate (PubChem CID 122200868) has the molecular formula C7H3ClF3NO5S
and a molecular weight of 305.62 g/mol. Its IUPAC name is (5-chloro-2-nitrophenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (5-chloro-2-nitrophenyl) trifluoromethanesulfonate |
| PubChem CID | 122200868 |
| Molecular Formula | C7H3ClF3NO5S |
| Molecular Weight | 305.62 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | (5-chloro-2-nitrophenyl) trifluoromethanesulfonate |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H3ClF3NO5S/c8-4-1-2-5(12(13)14)6(3-4)17-18(15,16)7(9,10)11/h1-3H |
| InChIKey | QCAWIUBRXIWAQT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2-nitrophenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-nitrophenyl) trifluoromethanesulfonate?
The IUPAC name of (5-chloro-2-nitrophenyl) trifluoromethanesulfonate (CID 122200868) is (5-chloro-2-nitrophenyl) trifluoromethanesulfonate.
What is the SMILES notation for (5-chloro-2-nitrophenyl) trifluoromethanesulfonate?
The canonical SMILES for (5-chloro-2-nitrophenyl) trifluoromethanesulfonate is O=[N+]([O-])c1ccc(Cl)cc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (5-chloro-2-nitrophenyl) trifluoromethanesulfonate?
The InChIKey is QCAWIUBRXIWAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClF3NO5S/c8-4-1-2-5(12(13)14)6(3-4)17-18(15,16)7(9,10)11/h1-3H.
What are the key properties of (5-chloro-2-nitrophenyl) trifluoromethanesulfonate?
(5-chloro-2-nitrophenyl) trifluoromethanesulfonate has a molecular weight of 305.62 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-nitrophenyl) trifluoromethanesulfonate is sourced from PubChem (CID 122200868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).