C8H4ClF2NO5 — CID 43651868
2-(4-chloro-2-nitrophenoxy)-2,2-difluoroacetic acid (PubChem CID 43651868) has the molecular formula C8H4ClF2NO5 and a molecular weight of 267.57 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenoxy)-2,2-difluoroacetic acid.
| Compound Name | 2-(4-chloro-2-nitrophenoxy)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 43651868 |
| Molecular Formula | C8H4ClF2NO5 |
| Molecular Weight | 267.57 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 2-(4-chloro-2-nitrophenoxy)-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)Oc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H4ClF2NO5/c9-4-1-2-6(5(3-4)12(15)16)17-8(10,11)7(13)14/h1-3H,(H,13,14) |
| InChIKey | CLWOYHDQRWVRAK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|