C9H4ClF6NO3 — CID 166610468
2-(4-chloro-2-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 166610468) has the molecular formula C9H4ClF6NO3 and a molecular weight of 323.58 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-chloro-2-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 166610468 |
| Molecular Formula | C9H4ClF6NO3 |
| Molecular Weight | 323.58 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 2-(4-chloro-2-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4ClF6NO3/c10-4-1-2-5(6(3-4)17(19)20)7(18,8(11,12)13)9(14,15)16/h1-3,18H |
| InChIKey | LHWFNIWEDYVVKS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|