C9H3F8NO3 — CID 166610434
2-(2,4-difluoro-5-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 166610434) has the molecular formula C9H3F8NO3 and a molecular weight of 325.11 g/mol. Its IUPAC name is 2-(2,4-difluoro-5-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2,4-difluoro-5-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 166610434 |
| Molecular Formula | C9H3F8NO3 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 2-(2,4-difluoro-5-nitrophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | O=[N+]([O-])c1cc(C(O)(C(F)(F)F)C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C9H3F8NO3/c10-4-2-5(11)6(18(20)21)1-3(4)7(19,8(12,13)14)9(15,16)17/h1-2,19H |
| InChIKey | QPRHHJVWWKCWTJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|