C12H6F6N2O4 — CID 171983224
7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-nitroquinolin-8-ol (PubChem CID 171983224) has the molecular formula C12H6F6N2O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-nitroquinolin-8-ol.
| Compound Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-nitroquinolin-8-ol |
|---|---|
| PubChem CID | 171983224 |
| Molecular Formula | C12H6F6N2O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-5-nitroquinolin-8-ol |
| SMILES | O=[N+]([O-])c1cc(C(O)(C(F)(F)F)C(F)(F)F)c(O)c2ncccc12 |
| InChI | InChI=1S/C12H6F6N2O4/c13-11(14,15)10(22,12(16,17)18)6-4-7(20(23)24)5-2-1-3-19-8(5)9(6)21/h1-4,21-22H |
| InChIKey | NMRFIJFWKXZJSM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|