About dichloropalladium;5-nitro-1,10-phenanthroline
dichloropalladium;5-nitro-1,10-phenanthroline (PubChem CID 5030888) has the molecular formula C12H7Cl2N3O2Pd
and a molecular weight of 402.53 g/mol. Its IUPAC name is dichloropalladium;5-nitro-1,10-phenanthroline.
Molecular Properties
| Compound Name | dichloropalladium;5-nitro-1,10-phenanthroline |
| PubChem CID | 5030888 |
| Molecular Formula | C12H7Cl2N3O2Pd |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 400.90 |
| IUPAC Name | dichloropalladium;5-nitro-1,10-phenanthroline |
| SMILES | Cl[Pd]Cl.O=[N+]([O-])c1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C12H7N3O2.2ClH.Pd/c16-15(17)10-7-8-3-1-5-13-11(8)12-9(10)4-2-6-14-12;;;/h1-7H;2*1H;/q;;;+2/p-2 |
| InChIKey | VEIBEGFXBVMHQQ-UHFFFAOYSA-L |
| XLogP | 4.07 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;5-nitro-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;5-nitro-1,10-phenanthroline?
The IUPAC name of dichloropalladium;5-nitro-1,10-phenanthroline (CID 5030888) is dichloropalladium;5-nitro-1,10-phenanthroline.
What is the SMILES notation for dichloropalladium;5-nitro-1,10-phenanthroline?
The canonical SMILES for dichloropalladium;5-nitro-1,10-phenanthroline is Cl[Pd]Cl.O=[N+]([O-])c1cc2cccnc2c2ncccc12.
What is the InChIKey of dichloropalladium;5-nitro-1,10-phenanthroline?
The InChIKey is VEIBEGFXBVMHQQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H7N3O2.2ClH.Pd/c16-15(17)10-7-8-3-1-5-13-11(8)12-9(10)4-2-6-14-12;;;/h1-7H;2*1H;/q;;;+2/p-2.
What are the key properties of dichloropalladium;5-nitro-1,10-phenanthroline?
dichloropalladium;5-nitro-1,10-phenanthroline has a molecular weight of 402.53 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;5-nitro-1,10-phenanthroline is sourced from PubChem (CID 5030888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).