C14H8N2 — CID 10703368
5-ethynyl-1,10-phenanthroline (PubChem CID 10703368) has the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-ethynyl-1,10-phenanthroline.
| Compound Name | 5-ethynyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 10703368 |
| Molecular Formula | C14H8N2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-ethynyl-1,10-phenanthroline |
| SMILES | C#Cc1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C14H8N2/c1-2-10-9-11-5-3-7-15-13(11)14-12(10)6-4-8-16-14/h1,3-9H |
| InChIKey | UGLYIDJFQYFXSZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|