C18H12N2Se — CID 138964900
5-phenylselanyl-1,10-phenanthroline (PubChem CID 138964900) has the molecular formula C18H12N2Se and a molecular weight of 335.27 g/mol. Its IUPAC name is 5-phenylselanyl-1,10-phenanthroline.
| Compound Name | 5-phenylselanyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 138964900 |
| Molecular Formula | C18H12N2Se |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 5-phenylselanyl-1,10-phenanthroline |
| SMILES | c1ccc([Se]c2cc3cccnc3c3ncccc23)cc1 |
| InChI | InChI=1S/C18H12N2Se/c1-2-7-14(8-3-1)21-16-12-13-6-4-10-19-17(13)18-15(16)9-5-11-20-18/h1-12H |
| InChIKey | KZGIVARYUJMSAS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|