C13H7N5 — CID 122642394
3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene (PubChem CID 122642394) has the molecular formula C13H7N5 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene.
| Compound Name | 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene |
|---|---|
| PubChem CID | 122642394 |
| Molecular Formula | C13H7N5 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3,6,9,12,15-pentazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15,17-nonaene |
| SMILES | c1cnc2c(c1)c1nccnc1c1nccnc21 |
| InChI | InChI=1S/C13H7N5/c1-2-8-9(14-3-1)11-13(18-7-6-17-11)12-10(8)15-4-5-16-12/h1-7H |
| InChIKey | DCLKGFWTQIIWSJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|