C14H9BN4O2 — CID 162715170
pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid (PubChem CID 162715170) has the molecular formula C14H9BN4O2 and a molecular weight of 276.06 g/mol. Its IUPAC name is pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid.
| Compound Name | pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid |
|---|---|
| PubChem CID | 162715170 |
| Molecular Formula | C14H9BN4O2 |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid |
| SMILES | OB(O)c1cnc2c(c1)c1nccnc1c1cccnc12 |
| InChI | InChI=1S/C14H9BN4O2/c20-15(21)8-6-10-13-11(17-4-5-18-13)9-2-1-3-16-12(9)14(10)19-7-8/h1-7,20-21H |
| InChIKey | STGFAPDBLWFJQL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|