pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid

C14H9BN4O2 — CID 162715170

IUPACpyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid
SMILESOB(O)c1cnc2c(c1)c1nccnc1c1cccnc12
InChIInChI=1S/C14H9BN4O2/c20-15(21)8-6-10-13-11(17-4-5-18-13)9-2-1-3-16-12(9)14(10)19-7-8/h1-7,20-21H
InChIKeySTGFAPDBLWFJQL-UHFFFAOYSA-N
MW276.06 g/mol
LogP0.41
Rot. Bonds1

About pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid

pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid (PubChem CID 162715170) has the molecular formula C14H9BN4O2 and a molecular weight of 276.06 g/mol. Its IUPAC name is pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid.

Molecular Properties

Compound Namepyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid
PubChem CID162715170
Molecular FormulaC14H9BN4O2
Molecular Weight276.06 g/mol
Exact Mass276.08
IUPAC Namepyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid
SMILESOB(O)c1cnc2c(c1)c1nccnc1c1cccnc12
InChIInChI=1S/C14H9BN4O2/c20-15(21)8-6-10-13-11(17-4-5-18-13)9-2-1-3-16-12(9)14(10)19-7-8/h1-7,20-21H
InChIKeySTGFAPDBLWFJQL-UHFFFAOYSA-N
XLogP0.41
TPSA92.02 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.06
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid?
The IUPAC name of pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid (CID 162715170) is pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid.
What is the SMILES notation for pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid?
The canonical SMILES for pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid is OB(O)c1cnc2c(c1)c1nccnc1c1cccnc12.
What is the InChIKey of pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid?
The InChIKey is STGFAPDBLWFJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BN4O2/c20-15(21)8-6-10-13-11(17-4-5-18-13)9-2-1-3-16-12(9)14(10)19-7-8/h1-7,20-21H.
What are the key properties of pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid?
pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid has a molecular weight of 276.06 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazino[2,3-f][1,10]phenanthrolin-6-ylboronic acid is sourced from PubChem (CID 162715170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).