C36H35B3N2O4S2 — CID 158431816
[9,10-bis(8-tritiooxyquinolin-5-yl)anthracen-2-yl]boronic acid;bis(dimethylborinothioic acid) (PubChem CID 158431816) has the molecular formula C36H35B3N2O4S2 and a molecular weight of 660.27 g/mol. Its IUPAC name is [9,10-bis(8-tritiooxyquinolin-5-yl)anthracen-2-yl]boronic acid;bis(dimethylborinothioic acid).
| Compound Name | [9,10-bis(8-tritiooxyquinolin-5-yl)anthracen-2-yl]boronic acid;bis(dimethylborinothioic acid) |
|---|---|
| PubChem CID | 158431816 |
| Molecular Formula | C36H35B3N2O4S2 |
| Molecular Weight | 660.27 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | [9,10-bis(8-tritiooxyquinolin-5-yl)anthracen-2-yl]boronic acid;bis(dimethylborinothioic acid) |
| SMILES | CB(C)S.CB(C)S.[3H]Oc1ccc(-c2c3ccccc3c(-c3ccc(O[3H])c4ncccc34)c3cc(B(O)O)ccc23)c2cccnc12 |
| InChI | InChI=1S/C32H21BN2O4.2C2H7BS/c36-27-13-11-21(24-7-3-15-34-31(24)27)29-19-5-1-2-6-20(19)30(26-17-18(33(38)39)9-10-23(26)29)22-12-14-28(37)32-25(22)8-4-16-35-32;2*1-3(2)4/h1-17,36-39H;2*4H,1-2H3/i/hT2 |
| InChIKey | HBTDLGRRFGMNQL-PWCQTSIFSA-N |
| XLogP | 7.85 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.27 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|