(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid

C34H25BO2 — CID 156787902

IUPAC(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid
SMILESOB(O)c1ccc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2c1
InChIInChI=1S/C34H25BO2/c36-35(37)28-21-22-29-30(23-28)32(25-15-7-2-8-16-25)34(27-19-11-4-12-20-27)33(26-17-9-3-10-18-26)31(29)24-13-5-1-6-14-24/h1-23,36-37H
InChIKeyHHNKBVGWNKYTMS-UHFFFAOYSA-N
MW476.38 g/mol
LogP7.19
Rot. Bonds5

About (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid

(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid (PubChem CID 156787902) has the molecular formula C34H25BO2 and a molecular weight of 476.38 g/mol. Its IUPAC name is (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid.

Molecular Properties

Compound Name(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid
PubChem CID156787902
Molecular FormulaC34H25BO2
Molecular Weight476.38 g/mol
Exact Mass476.19
IUPAC Name(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid
SMILESOB(O)c1ccc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2c1
InChIInChI=1S/C34H25BO2/c36-35(37)28-21-22-29-30(23-28)32(25-15-7-2-8-16-25)34(27-19-11-4-12-20-27)33(26-17-9-3-10-18-26)31(29)24-13-5-1-6-14-24/h1-23,36-37H
InChIKeyHHNKBVGWNKYTMS-UHFFFAOYSA-N
XLogP7.19
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms37
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500476.38
LogP ≤ 57.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid?
The IUPAC name of (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid (CID 156787902) is (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid.
What is the SMILES notation for (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid?
The canonical SMILES for (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid is OB(O)c1ccc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2c1.
What is the InChIKey of (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid?
The InChIKey is HHNKBVGWNKYTMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H25BO2/c36-35(37)28-21-22-29-30(23-28)32(25-15-7-2-8-16-25)34(27-19-11-4-12-20-27)33(26-17-9-3-10-18-26)31(29)24-13-5-1-6-14-24/h1-23,36-37H.
What are the key properties of (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid?
(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid has a molecular weight of 476.38 g/mol, XLogP of 7.19, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid is sourced from PubChem (CID 156787902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).