C34H25BO2 — CID 156787902
(5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid (PubChem CID 156787902) has the molecular formula C34H25BO2 and a molecular weight of 476.38 g/mol. Its IUPAC name is (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid.
| Compound Name | (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid |
|---|---|
| PubChem CID | 156787902 |
| Molecular Formula | C34H25BO2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (5,6,7,8-tetraphenylnaphthalen-2-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C34H25BO2/c36-35(37)28-21-22-29-30(23-28)32(25-15-7-2-8-16-25)34(27-19-11-4-12-20-27)33(26-17-9-3-10-18-26)31(29)24-13-5-1-6-14-24/h1-23,36-37H |
| InChIKey | HHNKBVGWNKYTMS-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|