C22H15BO2S2 — CID 175540732
(9,10-dithiophen-2-ylanthracen-2-yl)boronic acid (PubChem CID 175540732) has the molecular formula C22H15BO2S2 and a molecular weight of 386.31 g/mol. Its IUPAC name is (9,10-dithiophen-2-ylanthracen-2-yl)boronic acid.
| Compound Name | (9,10-dithiophen-2-ylanthracen-2-yl)boronic acid |
|---|---|
| PubChem CID | 175540732 |
| Molecular Formula | C22H15BO2S2 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (9,10-dithiophen-2-ylanthracen-2-yl)boronic acid |
| SMILES | OB(O)c1ccc2c(-c3cccs3)c3ccccc3c(-c3cccs3)c2c1 |
| InChI | InChI=1S/C22H15BO2S2/c24-23(25)14-9-10-17-18(13-14)22(20-8-4-12-27-20)16-6-2-1-5-15(16)21(17)19-7-3-11-26-19/h1-13,24-25H |
| InChIKey | NFUAJXAFPZKCOI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|