C32H18O2S4 — CID 163210788
1,3,6,8-tetrathiophen-2-ylpyrene-2,7-diol (PubChem CID 163210788) has the molecular formula C32H18O2S4 and a molecular weight of 562.76 g/mol. Its IUPAC name is 1,3,6,8-tetrathiophen-2-ylpyrene-2,7-diol.
| Compound Name | 1,3,6,8-tetrathiophen-2-ylpyrene-2,7-diol |
|---|---|
| PubChem CID | 163210788 |
| Molecular Formula | C32H18O2S4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 1,3,6,8-tetrathiophen-2-ylpyrene-2,7-diol |
| SMILES | Oc1c(-c2cccs2)c2ccc3c(-c4cccs4)c(O)c(-c4cccs4)c4ccc(c1-c1cccs1)c2c34 |
| InChI | InChI=1S/C32H18O2S4/c33-31-27(21-5-1-13-35-21)17-9-10-19-26-20(12-11-18(25(17)26)28(31)22-6-2-14-36-22)30(24-8-4-16-38-24)32(34)29(19)23-7-3-15-37-23/h1-16,33-34H |
| InChIKey | AEZIKKSHMNWYND-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|