About 2-thiophen-2-ylbenzene-1,3-diamine
2-thiophen-2-ylbenzene-1,3-diamine (PubChem CID 69383856) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-thiophen-2-ylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 2-thiophen-2-ylbenzene-1,3-diamine |
| PubChem CID | 69383856 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2-thiophen-2-ylbenzene-1,3-diamine |
| SMILES | Nc1cccc(N)c1-c1cccs1 |
| InChI | InChI=1S/C10H10N2S/c11-7-3-1-4-8(12)10(7)9-5-2-6-13-9/h1-6H,11-12H2 |
| InChIKey | FSGKEAVZTNFUMY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-thiophen-2-ylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylbenzene-1,3-diamine?
The IUPAC name of 2-thiophen-2-ylbenzene-1,3-diamine (CID 69383856) is 2-thiophen-2-ylbenzene-1,3-diamine.
What is the SMILES notation for 2-thiophen-2-ylbenzene-1,3-diamine?
The canonical SMILES for 2-thiophen-2-ylbenzene-1,3-diamine is Nc1cccc(N)c1-c1cccs1.
What is the InChIKey of 2-thiophen-2-ylbenzene-1,3-diamine?
The InChIKey is FSGKEAVZTNFUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c11-7-3-1-4-8(12)10(7)9-5-2-6-13-9/h1-6H,11-12H2.
What are the key properties of 2-thiophen-2-ylbenzene-1,3-diamine?
2-thiophen-2-ylbenzene-1,3-diamine has a molecular weight of 190.27 g/mol, XLogP of 2.58, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylbenzene-1,3-diamine is sourced from PubChem (CID 69383856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).