About thiophene;2-thiophen-2-ylthiophene
thiophene;2-thiophen-2-ylthiophene (PubChem CID 158809122) has the molecular formula C12H10S3
and a molecular weight of 250.41 g/mol. Its IUPAC name is thiophene;2-thiophen-2-ylthiophene.
Molecular Properties
| Compound Name | thiophene;2-thiophen-2-ylthiophene |
| PubChem CID | 158809122 |
| Molecular Formula | C12H10S3 |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | thiophene;2-thiophen-2-ylthiophene |
| SMILES | c1ccsc1.c1csc(-c2cccs2)c1 |
| InChI | InChI=1S/C8H6S2.C4H4S/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-5-3-1/h1-6H;1-4H |
| InChIKey | IULKOACDRUDJON-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophene;2-thiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene;2-thiophen-2-ylthiophene?
The IUPAC name of thiophene;2-thiophen-2-ylthiophene (CID 158809122) is thiophene;2-thiophen-2-ylthiophene.
What is the SMILES notation for thiophene;2-thiophen-2-ylthiophene?
The canonical SMILES for thiophene;2-thiophen-2-ylthiophene is c1ccsc1.c1csc(-c2cccs2)c1.
What is the InChIKey of thiophene;2-thiophen-2-ylthiophene?
The InChIKey is IULKOACDRUDJON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S2.C4H4S/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-4-5-3-1/h1-6H;1-4H.
What are the key properties of thiophene;2-thiophen-2-ylthiophene?
thiophene;2-thiophen-2-ylthiophene has a molecular weight of 250.41 g/mol, XLogP of 5.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene;2-thiophen-2-ylthiophene is sourced from PubChem (CID 158809122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).