About thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene
thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene (PubChem CID 161377996) has the molecular formula C20H14S5
and a molecular weight of 414.67 g/mol. Its IUPAC name is thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene.
Molecular Properties
| Compound Name | thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene |
| PubChem CID | 161377996 |
| Molecular Formula | C20H14S5 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene |
| SMILES | c1ccsc1.c1csc(-c2ccsc2-c2ccsc2-c2cccs2)c1 |
| InChI | InChI=1S/C16H10S4.C4H4S/c1-3-13(17-7-1)11-5-9-19-15(11)12-6-10-20-16(12)14-4-2-8-18-14;1-2-4-5-3-1/h1-10H;1-4H |
| InChIKey | VRIHXOVDYMUOHW-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene?
The IUPAC name of thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene (CID 161377996) is thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene.
What is the SMILES notation for thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene?
The canonical SMILES for thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene is c1ccsc1.c1csc(-c2ccsc2-c2ccsc2-c2cccs2)c1.
What is the InChIKey of thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene?
The InChIKey is VRIHXOVDYMUOHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10S4.C4H4S/c1-3-13(17-7-1)11-5-9-19-15(11)12-6-10-20-16(12)14-4-2-8-18-14;1-2-4-5-3-1/h1-10H;1-4H.
What are the key properties of thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene?
thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene has a molecular weight of 414.67 g/mol, XLogP of 8.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene;2-thiophen-2-yl-3-(3-thiophen-2-ylthiophen-2-yl)thiophene is sourced from PubChem (CID 161377996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).