C11H6OS4 — CID 15811354
4,5-dithiophen-2-yl-1,3-dithiol-2-one (PubChem CID 15811354) has the molecular formula C11H6OS4 and a molecular weight of 282.44 g/mol. Its IUPAC name is 4,5-dithiophen-2-yl-1,3-dithiol-2-one.
| Compound Name | 4,5-dithiophen-2-yl-1,3-dithiol-2-one |
|---|---|
| PubChem CID | 15811354 |
| Molecular Formula | C11H6OS4 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 4,5-dithiophen-2-yl-1,3-dithiol-2-one |
| SMILES | O=c1sc(-c2cccs2)c(-c2cccs2)s1 |
| InChI | InChI=1S/C11H6OS4/c12-11-15-9(7-3-1-5-13-7)10(16-11)8-4-2-6-14-8/h1-6H |
| InChIKey | BDBXVLAHAISXNV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |