C20H24S3 — CID 15778420
3,4-ditert-butyl-2,5-dithiophen-2-ylthiophene (PubChem CID 15778420) has the molecular formula C20H24S3 and a molecular weight of 360.61 g/mol. Its IUPAC name is 3,4-ditert-butyl-2,5-dithiophen-2-ylthiophene.
| Compound Name | 3,4-ditert-butyl-2,5-dithiophen-2-ylthiophene |
|---|---|
| PubChem CID | 15778420 |
| Molecular Formula | C20H24S3 |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3,4-ditert-butyl-2,5-dithiophen-2-ylthiophene |
| SMILES | CC(C)(C)c1c(-c2cccs2)sc(-c2cccs2)c1C(C)(C)C |
| InChI | InChI=1S/C20H24S3/c1-19(2,3)15-16(20(4,5)6)18(14-10-8-12-22-14)23-17(15)13-9-7-11-21-13/h7-12H,1-6H3 |
| InChIKey | XOIFPQRSOBFUEF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |