C14H6Br2S4 — CID 100972748
3,6-dibromo-2,5-dithiophen-2-ylthieno[3,2-b]thiophene (PubChem CID 100972748) has the molecular formula C14H6Br2S4 and a molecular weight of 462.28 g/mol. Its IUPAC name is 3,6-dibromo-2,5-dithiophen-2-ylthieno[3,2-b]thiophene.
| Compound Name | 3,6-dibromo-2,5-dithiophen-2-ylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 100972748 |
| Molecular Formula | C14H6Br2S4 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 459.77 |
| IUPAC Name | 3,6-dibromo-2,5-dithiophen-2-ylthieno[3,2-b]thiophene |
| SMILES | Brc1c(-c2cccs2)sc2c(Br)c(-c3cccs3)sc12 |
| InChI | InChI=1S/C14H6Br2S4/c15-9-11(7-3-1-5-17-7)19-14-10(16)12(20-13(9)14)8-4-2-6-18-8/h1-6H |
| InChIKey | AQQHMQLGPBUXNK-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |