C8H4Br2S2 — CID 24796079
2,3-dibromo-5-thiophen-2-ylthiophene (PubChem CID 24796079) has the molecular formula C8H4Br2S2 and a molecular weight of 324.06 g/mol. Its IUPAC name is 2,3-dibromo-5-thiophen-2-ylthiophene.
| Compound Name | 2,3-dibromo-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 24796079 |
| Molecular Formula | C8H4Br2S2 |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 321.81 |
| IUPAC Name | 2,3-dibromo-5-thiophen-2-ylthiophene |
| SMILES | Brc1cc(-c2cccs2)sc1Br |
| InChI | InChI=1S/C8H4Br2S2/c9-5-4-7(12-8(5)10)6-2-1-3-11-6/h1-4H |
| InChIKey | RYDSYAKOPIQWJF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |