C12H8S5 — CID 101208801
2,5-dithiophen-2-ylthiophene-3,4-dithiol (PubChem CID 101208801) has the molecular formula C12H8S5 and a molecular weight of 312.53 g/mol. Its IUPAC name is 2,5-dithiophen-2-ylthiophene-3,4-dithiol.
| Compound Name | 2,5-dithiophen-2-ylthiophene-3,4-dithiol |
|---|---|
| PubChem CID | 101208801 |
| Molecular Formula | C12H8S5 |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 311.92 |
| IUPAC Name | 2,5-dithiophen-2-ylthiophene-3,4-dithiol |
| SMILES | Sc1c(-c2cccs2)sc(-c2cccs2)c1S |
| InChI | InChI=1S/C12H8S5/c13-9-10(14)12(8-4-2-6-16-8)17-11(9)7-3-1-5-15-7/h1-6,13-14H |
| InChIKey | YIRSVCQEGGCDGY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|