C12H8N2S4 — CID 145426401
4-thionitroso-2,5-dithiophen-2-ylthiophen-3-amine (PubChem CID 145426401) has the molecular formula C12H8N2S4 and a molecular weight of 308.48 g/mol. Its IUPAC name is 4-thionitroso-2,5-dithiophen-2-ylthiophen-3-amine.
| Compound Name | 4-thionitroso-2,5-dithiophen-2-ylthiophen-3-amine |
|---|---|
| PubChem CID | 145426401 |
| Molecular Formula | C12H8N2S4 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 4-thionitroso-2,5-dithiophen-2-ylthiophen-3-amine |
| SMILES | Nc1c(-c2cccs2)sc(-c2cccs2)c1N=S |
| InChI | InChI=1S/C12H8N2S4/c13-9-10(14-15)12(8-4-2-6-17-8)18-11(9)7-3-1-5-16-7/h1-6H,13H2 |
| InChIKey | TXAIMJPNCMTJCW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |