C18H16N2O2S3 — CID 102108621
2,3-diethoxy-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine (PubChem CID 102108621) has the molecular formula C18H16N2O2S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is 2,3-diethoxy-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine.
| Compound Name | 2,3-diethoxy-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 102108621 |
| Molecular Formula | C18H16N2O2S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 2,3-diethoxy-5,7-dithiophen-2-ylthieno[3,4-b]pyrazine |
| SMILES | CCOc1nc2c(-c3cccs3)sc(-c3cccs3)c2nc1OCC |
| InChI | InChI=1S/C18H16N2O2S3/c1-3-21-17-18(22-4-2)20-14-13(19-17)15(11-7-5-9-23-11)25-16(14)12-8-6-10-24-12/h5-10H,3-4H2,1-2H3 |
| InChIKey | ZKRKFTRNHISUPE-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |