C12H16S2 — CID 142257628
2-methyl-5-thiophen-2-ylthiophene;propane (PubChem CID 142257628) has the molecular formula C12H16S2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-methyl-5-thiophen-2-ylthiophene;propane.
| Compound Name | 2-methyl-5-thiophen-2-ylthiophene;propane |
|---|---|
| PubChem CID | 142257628 |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-methyl-5-thiophen-2-ylthiophene;propane |
| SMILES | CCC.Cc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C9H8S2.C3H8/c1-7-4-5-9(11-7)8-3-2-6-10-8;1-3-2/h2-6H,1H3;3H2,1-2H3 |
| InChIKey | HAADMHJSMSXUPH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |