C32H46S4Si2 — CID 101060108
dibutyl-[dibutyl-(5-thiophen-2-ylthiophen-2-yl)silyl]-(5-thiophen-2-ylthiophen-2-yl)silane (PubChem CID 101060108) has the molecular formula C32H46S4Si2 and a molecular weight of 615.16 g/mol. Its IUPAC name is dibutyl-[dibutyl-(5-thiophen-2-ylthiophen-2-yl)silyl]-(5-thiophen-2-ylthiophen-2-yl)silane.
| Compound Name | dibutyl-[dibutyl-(5-thiophen-2-ylthiophen-2-yl)silyl]-(5-thiophen-2-ylthiophen-2-yl)silane |
|---|---|
| PubChem CID | 101060108 |
| Molecular Formula | C32H46S4Si2 |
| Molecular Weight | 615.16 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | dibutyl-[dibutyl-(5-thiophen-2-ylthiophen-2-yl)silyl]-(5-thiophen-2-ylthiophen-2-yl)silane |
| SMILES | CCCC[Si](CCCC)(c1ccc(-c2cccs2)s1)[Si](CCCC)(CCCC)c1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C32H46S4Si2/c1-5-9-23-37(24-10-6-2,31-19-17-29(35-31)27-15-13-21-33-27)38(25-11-7-3,26-12-8-4)32-20-18-30(36-32)28-16-14-22-34-28/h13-22H,5-12,23-26H2,1-4H3 |
| InChIKey | JASZVSDSYQILQU-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.16 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|