C56H78S6 — CID 59188449
2-[5-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-3,4-dioctyl-5-thiophen-2-ylthiophene (PubChem CID 59188449) has the molecular formula C56H78S6 and a molecular weight of 943.64 g/mol. Its IUPAC name is 2-[5-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-3,4-dioctyl-5-thiophen-2-ylthiophene.
| Compound Name | 2-[5-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-3,4-dioctyl-5-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 59188449 |
| Molecular Formula | C56H78S6 |
| Molecular Weight | 943.64 g/mol |
| Exact Mass | 942.44 |
| IUPAC Name | 2-[5-[5-(3,4-dioctyl-5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-3,4-dioctyl-5-thiophen-2-ylthiophene |
| SMILES | CCCCCCCCc1c(-c2cccs2)sc(-c2ccc(-c3ccc(-c4sc(-c5cccs5)c(CCCCCCCC)c4CCCCCCCC)s3)s2)c1CCCCCCCC |
| InChI | InChI=1S/C56H78S6/c1-5-9-13-17-21-25-31-43-45(33-27-23-19-15-11-7-3)55(61-53(43)49-35-29-41-57-49)51-39-37-47(59-51)48-38-40-52(60-48)56-46(34-28-24-20-16-12-8-4)44(32-26-22-18-14-10-6-2)54(62-56)50-36-30-42-58-50/h29-30,35-42H,5-28,31-34H2,1-4H3 |
| InChIKey | MTGFJBYCODSPCP-UHFFFAOYSA-N |
| XLogP | 22.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.64 |
| LogP ≤ 5 | 22.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|