C34H56S3Sn2 — CID 153302217
[5-[3,4-dioctyl-5-(5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane (PubChem CID 153302217) has the molecular formula C34H56S3Sn2 and a molecular weight of 798.44 g/mol. Its IUPAC name is [5-[3,4-dioctyl-5-(5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane.
| Compound Name | [5-[3,4-dioctyl-5-(5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 153302217 |
| Molecular Formula | C34H56S3Sn2 |
| Molecular Weight | 798.44 g/mol |
| Exact Mass | 800.16 |
| IUPAC Name | [5-[3,4-dioctyl-5-(5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane |
| SMILES | CCCCCCCCc1c(-c2ccc([Sn](C)(C)C)s2)sc(-c2ccc([Sn](C)(C)C)s2)c1CCCCCCCC |
| InChI | InChI=1S/C28H38S3.6CH3.2Sn/c1-3-5-7-9-11-13-17-23-24(18-14-12-10-8-6-4-2)28(26-20-16-22-30-26)31-27(23)25-19-15-21-29-25;;;;;;;;/h15-16,19-20H,3-14,17-18H2,1-2H3;6*1H3;; |
| InChIKey | XDGWSHZSHVCGRF-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.44 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|