C28H40S3 — CID 58730139
2,5-bis(4,5-dimethylthiophen-2-yl)-3,4-dihexylthiophene (PubChem CID 58730139) has the molecular formula C28H40S3 and a molecular weight of 472.83 g/mol. Its IUPAC name is 2,5-bis(4,5-dimethylthiophen-2-yl)-3,4-dihexylthiophene.
| Compound Name | 2,5-bis(4,5-dimethylthiophen-2-yl)-3,4-dihexylthiophene |
|---|---|
| PubChem CID | 58730139 |
| Molecular Formula | C28H40S3 |
| Molecular Weight | 472.83 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2,5-bis(4,5-dimethylthiophen-2-yl)-3,4-dihexylthiophene |
| SMILES | CCCCCCc1c(-c2cc(C)c(C)s2)sc(-c2cc(C)c(C)s2)c1CCCCCC |
| InChI | InChI=1S/C28H40S3/c1-7-9-11-13-15-23-24(16-14-12-10-8-2)28(26-18-20(4)22(6)30-26)31-27(23)25-17-19(3)21(5)29-25/h17-18H,7-16H2,1-6H3 |
| InChIKey | DIVLQWVDEPVPFO-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.83 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|