C17H24S2 — CID 23398510
2-(4,5-dimethylthiophen-2-yl)-3-hexyl-5-methylthiophene (PubChem CID 23398510) has the molecular formula C17H24S2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-(4,5-dimethylthiophen-2-yl)-3-hexyl-5-methylthiophene.
| Compound Name | 2-(4,5-dimethylthiophen-2-yl)-3-hexyl-5-methylthiophene |
|---|---|
| PubChem CID | 23398510 |
| Molecular Formula | C17H24S2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(4,5-dimethylthiophen-2-yl)-3-hexyl-5-methylthiophene |
| SMILES | CCCCCCc1cc(C)sc1-c1cc(C)c(C)s1 |
| InChI | InChI=1S/C17H24S2/c1-5-6-7-8-9-15-11-13(3)18-17(15)16-10-12(2)14(4)19-16/h10-11H,5-9H2,1-4H3 |
| InChIKey | ISNGTSCKDPHNDR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|