C36H42S4 — CID 58121713
3-hexyl-2-[5-[5-[3-hexyl-5-(3-methylphenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-5-methylthiophene (PubChem CID 58121713) has the molecular formula C36H42S4 and a molecular weight of 603.00 g/mol. Its IUPAC name is 3-hexyl-2-[5-[5-[3-hexyl-5-(3-methylphenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-5-methylthiophene.
| Compound Name | 3-hexyl-2-[5-[5-[3-hexyl-5-(3-methylphenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-5-methylthiophene |
|---|---|
| PubChem CID | 58121713 |
| Molecular Formula | C36H42S4 |
| Molecular Weight | 603.00 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 3-hexyl-2-[5-[5-[3-hexyl-5-(3-methylphenyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]-5-methylthiophene |
| SMILES | CCCCCCc1cc(C)sc1-c1ccc(-c2ccc(-c3sc(-c4cccc(C)c4)cc3CCCCCC)s2)s1 |
| InChI | InChI=1S/C36H42S4/c1-5-7-9-11-15-28-23-26(4)37-35(28)32-20-18-30(38-32)31-19-21-33(39-31)36-29(16-12-10-8-6-2)24-34(40-36)27-17-13-14-25(3)22-27/h13-14,17-24H,5-12,15-16H2,1-4H3 |
| InChIKey | NQFHVDOGGKOGJY-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.00 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|