C20H22BrNS2 — CID 159203469
2-bromo-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]pyridine (PubChem CID 159203469) has the molecular formula C20H22BrNS2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-bromo-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]pyridine.
| Compound Name | 2-bromo-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 159203469 |
| Molecular Formula | C20H22BrNS2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 2-bromo-4-[5-(3-hexyl-5-methylthiophen-2-yl)thiophen-2-yl]pyridine |
| SMILES | CCCCCCc1cc(C)sc1-c1ccc(-c2ccnc(Br)c2)s1 |
| InChI | InChI=1S/C20H22BrNS2/c1-3-4-5-6-7-16-12-14(2)23-20(16)18-9-8-17(24-18)15-10-11-22-19(21)13-15/h8-13H,3-7H2,1-2H3 |
| InChIKey | ZUYBVFKNUVHUKY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|