C30H48S3Sn2 — CID 170898127
[4-hexyl-5-[5-(3-hexyl-5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane (PubChem CID 170898127) has the molecular formula C30H48S3Sn2 and a molecular weight of 742.34 g/mol. Its IUPAC name is [4-hexyl-5-[5-(3-hexyl-5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane.
| Compound Name | [4-hexyl-5-[5-(3-hexyl-5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 170898127 |
| Molecular Formula | C30H48S3Sn2 |
| Molecular Weight | 742.34 g/mol |
| Exact Mass | 744.10 |
| IUPAC Name | [4-hexyl-5-[5-(3-hexyl-5-trimethylstannylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-trimethylstannane |
| SMILES | CCCCCCc1cc([Sn](C)(C)C)sc1-c1ccc(-c2sc([Sn](C)(C)C)cc2CCCCCC)s1 |
| InChI | InChI=1S/C24H30S3.6CH3.2Sn/c1-3-5-7-9-11-19-15-17-25-23(19)21-13-14-22(27-21)24-20(16-18-26-24)12-10-8-6-4-2;;;;;;;;/h13-16H,3-12H2,1-2H3;6*1H3;; |
| InChIKey | XBMGWJHTCLBEEV-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.34 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|