C18H36SSn2 — CID 154725648
trimethyl-(3-octyl-5-trimethylstannylthiophen-2-yl)stannane (PubChem CID 154725648) has the molecular formula C18H36SSn2 and a molecular weight of 521.98 g/mol. Its IUPAC name is trimethyl-(3-octyl-5-trimethylstannylthiophen-2-yl)stannane.
| Compound Name | trimethyl-(3-octyl-5-trimethylstannylthiophen-2-yl)stannane |
|---|---|
| PubChem CID | 154725648 |
| Molecular Formula | C18H36SSn2 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | trimethyl-(3-octyl-5-trimethylstannylthiophen-2-yl)stannane |
| SMILES | CCCCCCCCc1cc([Sn](C)(C)C)sc1[Sn](C)(C)C |
| InChI | InChI=1S/C12H18S.6CH3.2Sn/c1-2-3-4-5-6-7-8-12-9-10-13-11-12;;;;;;;;/h9H,2-8H2,1H3;6*1H3;; |
| InChIKey | QYFVWNIYYFMIHW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|