C32H54S2Sn2 — CID 66653400
(4,8-dioctyl-2-trimethylstannylthieno[3,2-f][1]benzothiol-6-yl)-trimethylstannane (PubChem CID 66653400) has the molecular formula C32H54S2Sn2 and a molecular weight of 740.34 g/mol. Its IUPAC name is (4,8-dioctyl-2-trimethylstannylthieno[3,2-f][1]benzothiol-6-yl)-trimethylstannane.
| Compound Name | (4,8-dioctyl-2-trimethylstannylthieno[3,2-f][1]benzothiol-6-yl)-trimethylstannane |
|---|---|
| PubChem CID | 66653400 |
| Molecular Formula | C32H54S2Sn2 |
| Molecular Weight | 740.34 g/mol |
| Exact Mass | 742.17 |
| IUPAC Name | (4,8-dioctyl-2-trimethylstannylthieno[3,2-f][1]benzothiol-6-yl)-trimethylstannane |
| SMILES | CCCCCCCCc1c2cc([Sn](C)(C)C)sc2c(CCCCCCCC)c2sc([Sn](C)(C)C)cc12 |
| InChI | InChI=1S/C26H36S2.6CH3.2Sn/c1-3-5-7-9-11-13-15-21-22-17-19-27-25(22)24(26-23(21)18-20-28-26)16-14-12-10-8-6-4-2;;;;;;;;/h17-18H,3-16H2,1-2H3;6*1H3;; |
| InChIKey | FRMKHRVTZUFWPP-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.34 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|