C26H39IS2Sn2 — CID 163705261
(5-dec-1-en-3-yl-4-iodo-2-trimethylstannylthieno[3,2-g][1]benzothiol-7-yl)-trimethylstannane (PubChem CID 163705261) has the molecular formula C26H39IS2Sn2 and a molecular weight of 780.06 g/mol. Its IUPAC name is (5-dec-1-en-3-yl-4-iodo-2-trimethylstannylthieno[3,2-g][1]benzothiol-7-yl)-trimethylstannane.
| Compound Name | (5-dec-1-en-3-yl-4-iodo-2-trimethylstannylthieno[3,2-g][1]benzothiol-7-yl)-trimethylstannane |
|---|---|
| PubChem CID | 163705261 |
| Molecular Formula | C26H39IS2Sn2 |
| Molecular Weight | 780.06 g/mol |
| Exact Mass | 781.96 |
| IUPAC Name | (5-dec-1-en-3-yl-4-iodo-2-trimethylstannylthieno[3,2-g][1]benzothiol-7-yl)-trimethylstannane |
| SMILES | C=CC(CCCCCCC)c1c(I)c2cc([Sn](C)(C)C)sc2c2sc([Sn](C)(C)C)cc12 |
| InChI | InChI=1S/C20H21IS2.6CH3.2Sn/c1-3-5-6-7-8-9-14(4-2)17-15-10-12-22-19(15)20-16(18(17)21)11-13-23-20;;;;;;;;/h4,10-11,14H,2-3,5-9H2,1H3;6*1H3;; |
| InChIKey | KENFFDKWLMSNJL-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.06 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|