C54H88N2O2S2Sn2 — CID 153324554
9,19-bis(2-hexyldecyl)-6,16-bis(trimethylstannyl)-5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione (PubChem CID 153324554) has the molecular formula C54H88N2O2S2Sn2 and a molecular weight of 1098.87 g/mol. Its IUPAC name is 9,19-bis(2-hexyldecyl)-6,16-bis(trimethylstannyl)-5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione.
| Compound Name | 9,19-bis(2-hexyldecyl)-6,16-bis(trimethylstannyl)-5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione |
|---|---|
| PubChem CID | 153324554 |
| Molecular Formula | C54H88N2O2S2Sn2 |
| Molecular Weight | 1098.87 g/mol |
| Exact Mass | 1100.43 |
| IUPAC Name | 9,19-bis(2-hexyldecyl)-6,16-bis(trimethylstannyl)-5,15-dithia-9,19-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),2,4(8),6,11,14(18),16-heptaene-10,20-dione |
| SMILES | CCCCCCCCC(CCCCCC)Cn1c(=O)c2cc3c(cc2c2sc([Sn](C)(C)C)cc21)c(=O)n(CC(CCCCCC)CCCCCCCC)c1cc([Sn](C)(C)C)sc31 |
| InChI | InChI=1S/C48H70N2O2S2.6CH3.2Sn/c1-5-9-13-17-19-23-27-37(25-21-15-11-7-3)35-49-43-29-31-53-45(43)39-34-42-40(33-41(39)47(49)51)46-44(30-32-54-46)50(48(42)52)36-38(26-22-16-12-8-4)28-24-20-18-14-10-6-2;;;;;;;;/h29-30,33-34,37-38H,5-28,35-36H2,1-4H3;6*1H3;; |
| InChIKey | FBHHOKZZQVBZAG-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.87 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|