C40H58S4Sn2 — CID 131697925
[4,8-bis(5-octan-3-ylthiophen-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane (PubChem CID 131697925) has the molecular formula C40H58S4Sn2 and a molecular weight of 904.59 g/mol. Its IUPAC name is [4,8-bis(5-octan-3-ylthiophen-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane.
| Compound Name | [4,8-bis(5-octan-3-ylthiophen-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane |
|---|---|
| PubChem CID | 131697925 |
| Molecular Formula | C40H58S4Sn2 |
| Molecular Weight | 904.59 g/mol |
| Exact Mass | 906.15 |
| IUPAC Name | [4,8-bis(5-octan-3-ylthiophen-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane |
| SMILES | CCCCCC(CC)c1ccc(-c2c3cc([Sn](C)(C)C)sc3c(-c3ccc(C(CC)CCCCC)s3)c3cc([Sn](C)(C)C)sc23)s1 |
| InChI | InChI=1S/C34H40S4.6CH3.2Sn/c1-5-9-11-13-23(7-3)27-15-17-29(37-27)31-25-19-21-36-34(25)32(26-20-22-35-33(26)31)30-18-16-28(38-30)24(8-4)14-12-10-6-2;;;;;;;;/h15-20,23-24H,5-14H2,1-4H3;6*1H3;; |
| InChIKey | IVRBLVVDHKACMB-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.59 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|