C46H80S2Sn — CID 158936698
trimethyl-[6-methyl-4,8-bis(3-pentylundecyl)thieno[2,3-f][1]benzothiol-2-yl]stannane (PubChem CID 158936698) has the molecular formula C46H80S2Sn and a molecular weight of 815.99 g/mol. Its IUPAC name is trimethyl-[6-methyl-4,8-bis(3-pentylundecyl)thieno[2,3-f][1]benzothiol-2-yl]stannane.
| Compound Name | trimethyl-[6-methyl-4,8-bis(3-pentylundecyl)thieno[2,3-f][1]benzothiol-2-yl]stannane |
|---|---|
| PubChem CID | 158936698 |
| Molecular Formula | C46H80S2Sn |
| Molecular Weight | 815.99 g/mol |
| Exact Mass | 816.47 |
| IUPAC Name | trimethyl-[6-methyl-4,8-bis(3-pentylundecyl)thieno[2,3-f][1]benzothiol-2-yl]stannane |
| SMILES | CCCCCCCCC(CCCCC)CCc1c2cc([Sn](C)(C)C)sc2c(CCC(CCCCC)CCCCCCCC)c2cc(C)sc12 |
| InChI | InChI=1S/C43H71S2.3CH3.Sn/c1-6-10-14-16-18-22-26-36(24-20-12-8-3)28-30-38-40-32-33-44-42(40)39(41-34-35(5)45-43(38)41)31-29-37(25-21-13-9-4)27-23-19-17-15-11-7-2;;;;/h32,34,36-37H,6-31H2,1-5H3;3*1H3; |
| InChIKey | DJBQIPWOSOTNRS-UHFFFAOYSA-N |
| XLogP | 16.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.99 |
| LogP ≤ 5 | 16.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|