C36H50O2S2Sn2 — CID 177391534
[4,8-bis(5-hexylfuran-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane (PubChem CID 177391534) has the molecular formula C36H50O2S2Sn2 and a molecular weight of 816.35 g/mol. Its IUPAC name is [4,8-bis(5-hexylfuran-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane.
| Compound Name | [4,8-bis(5-hexylfuran-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane |
|---|---|
| PubChem CID | 177391534 |
| Molecular Formula | C36H50O2S2Sn2 |
| Molecular Weight | 816.35 g/mol |
| Exact Mass | 818.13 |
| IUPAC Name | [4,8-bis(5-hexylfuran-2-yl)-2-trimethylstannylthieno[2,3-f][1]benzothiol-6-yl]-trimethylstannane |
| SMILES | CCCCCCc1ccc(-c2c3cc([Sn](C)(C)C)sc3c(-c3ccc(CCCCCC)o3)c3cc([Sn](C)(C)C)sc23)o1 |
| InChI | InChI=1S/C30H32O2S2.6CH3.2Sn/c1-3-5-7-9-11-21-13-15-25(31-21)27-23-17-19-34-30(23)28(24-18-20-33-29(24)27)26-16-14-22(32-26)12-10-8-6-4-2;;;;;;;;/h13-18H,3-12H2,1-2H3;6*1H3;; |
| InChIKey | ILNREPYIGGRYSE-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.35 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|