C32H44O2S2 — CID 90361979
14,15-bis(2-ethylhexoxy)-4,9-dimethyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene (PubChem CID 90361979) has the molecular formula C32H44O2S2 and a molecular weight of 524.84 g/mol. Its IUPAC name is 14,15-bis(2-ethylhexoxy)-4,9-dimethyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene.
| Compound Name | 14,15-bis(2-ethylhexoxy)-4,9-dimethyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene |
|---|---|
| PubChem CID | 90361979 |
| Molecular Formula | C32H44O2S2 |
| Molecular Weight | 524.84 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 14,15-bis(2-ethylhexoxy)-4,9-dimethyl-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),3,7(11),9,12,14-heptaene |
| SMILES | CCCCC(CC)COc1cc2c(cc1OCC(CC)CCCC)c1cc(C)sc1c1sc(C)cc21 |
| InChI | InChI=1S/C32H44O2S2/c1-7-11-13-23(9-3)19-33-29-17-25-26(18-30(29)34-20-24(10-4)14-12-8-2)28-16-22(6)36-32(28)31-27(25)15-21(5)35-31/h15-18,23-24H,7-14,19-20H2,1-6H3 |
| InChIKey | OCKLANBNOVYLTG-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.84 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |