C32H44I2O4 — CID 91392165
9,10-bis(2-ethylhexoxy)-2,7-diiodo-3,6-dimethoxyphenanthrene (PubChem CID 91392165) has the molecular formula C32H44I2O4 and a molecular weight of 746.51 g/mol. Its IUPAC name is 9,10-bis(2-ethylhexoxy)-2,7-diiodo-3,6-dimethoxyphenanthrene.
| Compound Name | 9,10-bis(2-ethylhexoxy)-2,7-diiodo-3,6-dimethoxyphenanthrene |
|---|---|
| PubChem CID | 91392165 |
| Molecular Formula | C32H44I2O4 |
| Molecular Weight | 746.51 g/mol |
| Exact Mass | 746.13 |
| IUPAC Name | 9,10-bis(2-ethylhexoxy)-2,7-diiodo-3,6-dimethoxyphenanthrene |
| SMILES | CCCCC(CC)COc1c(OCC(CC)CCCC)c2cc(I)c(OC)cc2c2cc(OC)c(I)cc12 |
| InChI | InChI=1S/C32H44I2O4/c1-7-11-13-21(9-3)19-37-31-25-15-27(33)29(35-5)17-23(25)24-18-30(36-6)28(34)16-26(24)32(31)38-20-22(10-4)14-12-8-2/h15-18,21-22H,7-14,19-20H2,1-6H3 |
| InChIKey | LQIZHVGDPHEHPR-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.51 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|